C25H24N4O5 — CID 157393763
ethyl 2-(4-methoxy-1,3-benzoxazol-2-yl)-3-oxobutanoate;5-ethynyl-4-phenyl-1H-pyrazol-3-amine (PubChem CID 157393763) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is ethyl 2-(4-methoxy-1,3-benzoxazol-2-yl)-3-oxobutanoate;5-ethynyl-4-phenyl-1H-pyrazol-3-amine.
| Compound Name | ethyl 2-(4-methoxy-1,3-benzoxazol-2-yl)-3-oxobutanoate;5-ethynyl-4-phenyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 157393763 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | ethyl 2-(4-methoxy-1,3-benzoxazol-2-yl)-3-oxobutanoate;5-ethynyl-4-phenyl-1H-pyrazol-3-amine |
| SMILES | C#Cc1[nH]nc(N)c1-c1ccccc1.CCOC(=O)C(C(C)=O)c1nc2c(OC)cccc2o1 |
| InChI | InChI=1S/C14H15NO5.C11H9N3/c1-4-19-14(17)11(8(2)16)13-15-12-9(18-3)6-5-7-10(12)20-13;1-2-9-10(11(12)14-13-9)8-6-4-3-5-7-8/h5-7,11H,4H2,1-3H3;1,3-7H,(H3,12,13,14) |
| InChIKey | BMICKJPKJAVDPT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 133.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|