C12H13N3O3 — CID 82086444
3-amino-4-(4-methoxy-3-methylphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 82086444) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 3-amino-4-(4-methoxy-3-methylphenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-amino-4-(4-methoxy-3-methylphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82086444 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-amino-4-(4-methoxy-3-methylphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | COc1ccc(-c2c(N)n[nH]c2C(=O)O)cc1C |
| InChI | InChI=1S/C12H13N3O3/c1-6-5-7(3-4-8(6)18-2)9-10(12(16)17)14-15-11(9)13/h3-5H,1-2H3,(H,16,17)(H3,13,14,15) |
| InChIKey | DITDAUNPCXNGFB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |