C12H13N3O4 — CID 22905823
4-amino-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 22905823) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 4-amino-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 4-amino-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 22905823 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 4-amino-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | COc1ccc(-c2n[nH]c(C(=O)O)c2N)cc1OC |
| InChI | InChI=1S/C12H13N3O4/c1-18-7-4-3-6(5-8(7)19-2)10-9(13)11(12(16)17)15-14-10/h3-5H,13H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | HWGXMIXMHHCASB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |