C14H14N2O4 — CID 53229467
6-amino-3-(3,4-dimethoxyphenyl)pyridine-2-carboxylic acid (PubChem CID 53229467) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 6-amino-3-(3,4-dimethoxyphenyl)pyridine-2-carboxylic acid.
| Compound Name | 6-amino-3-(3,4-dimethoxyphenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 53229467 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 6-amino-3-(3,4-dimethoxyphenyl)pyridine-2-carboxylic acid |
| SMILES | COc1ccc(-c2ccc(N)nc2C(=O)O)cc1OC |
| InChI | InChI=1S/C14H14N2O4/c1-19-10-5-3-8(7-11(10)20-2)9-4-6-12(15)16-13(9)14(17)18/h3-7H,1-2H3,(H2,15,16)(H,17,18) |
| InChIKey | FFQZSLUTBFQFAJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |