4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid

C18H16N2O4 — CID 1478012

IUPAC4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid
SMILESCOc1ccc(-c2cn(-c3ccccc3)nc2C(=O)O)cc1OC
InChIInChI=1S/C18H16N2O4/c1-23-15-9-8-12(10-16(15)24-2)14-11-20(19-17(14)18(21)22)13-6-4-3-5-7-13/h3-11H,1-2H3,(H,21,22)
InChIKeyMSYZXDXEOGMMEE-UHFFFAOYSA-N
MW324.34 g/mol
LogP3.25
Rot. Bonds5

About 4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid

4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid (PubChem CID 1478012) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid.

Molecular Properties

Compound Name4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid
PubChem CID1478012
Molecular FormulaC18H16N2O4
Molecular Weight324.34 g/mol
Exact Mass324.11
IUPAC Name4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid
SMILESCOc1ccc(-c2cn(-c3ccccc3)nc2C(=O)O)cc1OC
InChIInChI=1S/C18H16N2O4/c1-23-15-9-8-12(10-16(15)24-2)14-11-20(19-17(14)18(21)22)13-6-4-3-5-7-13/h3-11H,1-2H3,(H,21,22)
InChIKeyMSYZXDXEOGMMEE-UHFFFAOYSA-N
XLogP3.25
TPSA73.58 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.34
LogP ≤ 53.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid?
The IUPAC name of 4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid (CID 1478012) is 4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid.
What is the SMILES notation for 4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid?
The canonical SMILES for 4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid is COc1ccc(-c2cn(-c3ccccc3)nc2C(=O)O)cc1OC.
What is the InChIKey of 4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid?
The InChIKey is MSYZXDXEOGMMEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4/c1-23-15-9-8-12(10-16(15)24-2)14-11-20(19-17(14)18(21)22)13-6-4-3-5-7-13/h3-11H,1-2H3,(H,21,22).
What are the key properties of 4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid?
4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid has a molecular weight of 324.34 g/mol, XLogP of 3.25, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyphenyl)-1-phenylpyrazole-3-carboxylic acid is sourced from PubChem (CID 1478012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).