C26H32N4O4 — CID 55847917
4-(3,4-dimethoxyphenyl)-N-(4-morpholin-4-ylbutyl)-1-phenylpyrazole-3-carboxamide (PubChem CID 55847917) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-(4-morpholin-4-ylbutyl)-1-phenylpyrazole-3-carboxamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-(4-morpholin-4-ylbutyl)-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55847917 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-(4-morpholin-4-ylbutyl)-1-phenylpyrazole-3-carboxamide |
| SMILES | COc1ccc(-c2cn(-c3ccccc3)nc2C(=O)NCCCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C26H32N4O4/c1-32-23-11-10-20(18-24(23)33-2)22-19-30(21-8-4-3-5-9-21)28-25(22)26(31)27-12-6-7-13-29-14-16-34-17-15-29/h3-5,8-11,18-19H,6-7,12-17H2,1-2H3,(H,27,31) |
| InChIKey | DHLRQNZHTIBYKV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|