C23H27N3O3 — CID 18149038
N-butyl-4-(3,4-dimethoxyphenyl)-N-methyl-1-phenylpyrazole-3-carboxamide (PubChem CID 18149038) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-butyl-4-(3,4-dimethoxyphenyl)-N-methyl-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-butyl-4-(3,4-dimethoxyphenyl)-N-methyl-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 18149038 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-butyl-4-(3,4-dimethoxyphenyl)-N-methyl-1-phenylpyrazole-3-carboxamide |
| SMILES | CCCCN(C)C(=O)c1nn(-c2ccccc2)cc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H27N3O3/c1-5-6-14-25(2)23(27)22-19(16-26(24-22)18-10-8-7-9-11-18)17-12-13-20(28-3)21(15-17)29-4/h7-13,15-16H,5-6,14H2,1-4H3 |
| InChIKey | BPPXGOBVSCIJLD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |