C25H30N4O5 — CID 55488628
3-(3,4-dimethoxyphenyl)-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1-phenylpyrazole-4-carboxamide (PubChem CID 55488628) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55488628 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1-phenylpyrazole-4-carboxamide |
| SMILES | COCCCNC(=O)CN(C)C(=O)c1cn(-c2ccccc2)nc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H30N4O5/c1-28(17-23(30)26-13-8-14-32-2)25(31)20-16-29(19-9-6-5-7-10-19)27-24(20)18-11-12-21(33-3)22(15-18)34-4/h5-7,9-12,15-16H,8,13-14,17H2,1-4H3,(H,26,30) |
| InChIKey | SFODSLSYCPCPIN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|