C18H15NO5 — CID 11370771
5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole-4-carboxylic acid (PubChem CID 11370771) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole-4-carboxylic acid.
| Compound Name | 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 11370771 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole-4-carboxylic acid |
| SMILES | COc1ccc(-c2oc(-c3ccccc3)nc2C(=O)O)cc1OC |
| InChI | InChI=1S/C18H15NO5/c1-22-13-9-8-12(10-14(13)23-2)16-15(18(20)21)19-17(24-16)11-6-4-3-5-7-11/h3-10H,1-2H3,(H,20,21) |
| InChIKey | XTCWHCJANANIES-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |