C12H8FNO6 — CID 102953955
2-(3-fluoro-4-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid (PubChem CID 102953955) has the molecular formula C12H8FNO6 and a molecular weight of 281.19 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 102953955 |
| Molecular Formula | C12H8FNO6 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylic acid |
| SMILES | COc1ccc(-c2nc(C(=O)O)c(C(=O)O)o2)cc1F |
| InChI | InChI=1S/C12H8FNO6/c1-19-7-3-2-5(4-6(7)13)10-14-8(11(15)16)9(20-10)12(17)18/h2-4H,1H3,(H,15,16)(H,17,18) |
| InChIKey | CRJGAENOULVOBP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |