C15H10FNO4 — CID 81332827
2-(3-fluoro-4-methoxyphenyl)-1,3-benzoxazole-7-carboxylic acid (PubChem CID 81332827) has the molecular formula C15H10FNO4 and a molecular weight of 287.25 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-1,3-benzoxazole-7-carboxylic acid.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-1,3-benzoxazole-7-carboxylic acid |
|---|---|
| PubChem CID | 81332827 |
| Molecular Formula | C15H10FNO4 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-1,3-benzoxazole-7-carboxylic acid |
| SMILES | COc1ccc(-c2nc3cccc(C(=O)O)c3o2)cc1F |
| InChI | InChI=1S/C15H10FNO4/c1-20-12-6-5-8(7-10(12)16)14-17-11-4-2-3-9(15(18)19)13(11)21-14/h2-7H,1H3,(H,18,19) |
| InChIKey | OHYJJXIBMAXTKZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |