C15H10BrNO4 — CID 115370381
2-(4-bromo-2-methoxyphenyl)-1,3-benzoxazole-7-carboxylic acid (PubChem CID 115370381) has the molecular formula C15H10BrNO4 and a molecular weight of 348.15 g/mol. Its IUPAC name is 2-(4-bromo-2-methoxyphenyl)-1,3-benzoxazole-7-carboxylic acid.
| Compound Name | 2-(4-bromo-2-methoxyphenyl)-1,3-benzoxazole-7-carboxylic acid |
|---|---|
| PubChem CID | 115370381 |
| Molecular Formula | C15H10BrNO4 |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-(4-bromo-2-methoxyphenyl)-1,3-benzoxazole-7-carboxylic acid |
| SMILES | COc1cc(Br)ccc1-c1nc2cccc(C(=O)O)c2o1 |
| InChI | InChI=1S/C15H10BrNO4/c1-20-12-7-8(16)5-6-9(12)14-17-11-4-2-3-10(15(18)19)13(11)21-14/h2-7H,1H3,(H,18,19) |
| InChIKey | IHFFXJXDCOEMQZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |