C16H12FNO3 — CID 59741629
7-ethenyl-2-(3-fluoro-4-methoxyphenyl)-1,3-benzoxazol-5-ol (PubChem CID 59741629) has the molecular formula C16H12FNO3 and a molecular weight of 285.27 g/mol. Its IUPAC name is 7-ethenyl-2-(3-fluoro-4-methoxyphenyl)-1,3-benzoxazol-5-ol.
| Compound Name | 7-ethenyl-2-(3-fluoro-4-methoxyphenyl)-1,3-benzoxazol-5-ol |
|---|---|
| PubChem CID | 59741629 |
| Molecular Formula | C16H12FNO3 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 7-ethenyl-2-(3-fluoro-4-methoxyphenyl)-1,3-benzoxazol-5-ol |
| SMILES | C=Cc1cc(O)cc2nc(-c3ccc(OC)c(F)c3)oc12 |
| InChI | InChI=1S/C16H12FNO3/c1-3-9-6-11(19)8-13-15(9)21-16(18-13)10-4-5-14(20-2)12(17)7-10/h3-8,19H,1H2,2H3 |
| InChIKey | ZCCFCHXYJDEYFX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |