C15H17FN3O6P — CID 67392934
diazanium;[4-(7-ethenyl-5-hydroxy-1,3-benzoxazol-2-yl)-2-fluorophenyl] phosphate (PubChem CID 67392934) has the molecular formula C15H17FN3O6P and a molecular weight of 385.29 g/mol. Its IUPAC name is diazanium;[4-(7-ethenyl-5-hydroxy-1,3-benzoxazol-2-yl)-2-fluorophenyl] phosphate.
| Compound Name | diazanium;[4-(7-ethenyl-5-hydroxy-1,3-benzoxazol-2-yl)-2-fluorophenyl] phosphate |
|---|---|
| PubChem CID | 67392934 |
| Molecular Formula | C15H17FN3O6P |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | diazanium;[4-(7-ethenyl-5-hydroxy-1,3-benzoxazol-2-yl)-2-fluorophenyl] phosphate |
| SMILES | C=Cc1cc(O)cc2nc(-c3ccc(OP(=O)([O-])[O-])c(F)c3)oc12.[NH4+].[NH4+] |
| InChI | InChI=1S/C15H11FNO6P.2H3N/c1-2-8-5-10(18)7-12-14(8)22-15(17-12)9-3-4-13(11(16)6-9)23-24(19,20)21;;/h2-7,18H,1H2,(H2,19,20,21);2*1H3 |
| InChIKey | AHSKQSFCROSHLJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 191.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|