C21H24FNO6SSi — CID 24900533
[4-[5-[tert-butyl(dimethyl)silyl]oxy-7-ethenyl-1,3-benzoxazol-2-yl]-2-fluorophenyl] hydrogen sulfate (PubChem CID 24900533) has the molecular formula C21H24FNO6SSi and a molecular weight of 465.58 g/mol. Its IUPAC name is [4-[5-[tert-butyl(dimethyl)silyl]oxy-7-ethenyl-1,3-benzoxazol-2-yl]-2-fluorophenyl] hydrogen sulfate.
| Compound Name | [4-[5-[tert-butyl(dimethyl)silyl]oxy-7-ethenyl-1,3-benzoxazol-2-yl]-2-fluorophenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 24900533 |
| Molecular Formula | C21H24FNO6SSi |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | [4-[5-[tert-butyl(dimethyl)silyl]oxy-7-ethenyl-1,3-benzoxazol-2-yl]-2-fluorophenyl] hydrogen sulfate |
| SMILES | C=Cc1cc(O[Si](C)(C)C(C)(C)C)cc2nc(-c3ccc(OS(=O)(=O)O)c(F)c3)oc12 |
| InChI | InChI=1S/C21H24FNO6SSi/c1-7-13-10-15(29-31(5,6)21(2,3)4)12-17-19(13)27-20(23-17)14-8-9-18(16(22)11-14)28-30(24,25)26/h7-12H,1H2,2-6H3,(H,24,25,26) |
| InChIKey | XTNJZTZXHUOMRO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|