C13H11NO5 — CID 102953844
2-(3,5-dimethylphenyl)-1,3-oxazole-4,5-dicarboxylic acid (PubChem CID 102953844) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-1,3-oxazole-4,5-dicarboxylic acid.
| Compound Name | 2-(3,5-dimethylphenyl)-1,3-oxazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 102953844 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-1,3-oxazole-4,5-dicarboxylic acid |
| SMILES | Cc1cc(C)cc(-c2nc(C(=O)O)c(C(=O)O)o2)c1 |
| InChI | InChI=1S/C13H11NO5/c1-6-3-7(2)5-8(4-6)11-14-9(12(15)16)10(19-11)13(17)18/h3-5H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | NKFHQUOWKFUMGE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |