C9H4ClNO5S — CID 102953780
2-(3-chlorothiophen-2-yl)-1,3-oxazole-4,5-dicarboxylic acid (PubChem CID 102953780) has the molecular formula C9H4ClNO5S and a molecular weight of 273.65 g/mol. Its IUPAC name is 2-(3-chlorothiophen-2-yl)-1,3-oxazole-4,5-dicarboxylic acid.
| Compound Name | 2-(3-chlorothiophen-2-yl)-1,3-oxazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 102953780 |
| Molecular Formula | C9H4ClNO5S |
| Molecular Weight | 273.65 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | 2-(3-chlorothiophen-2-yl)-1,3-oxazole-4,5-dicarboxylic acid |
| SMILES | O=C(O)c1nc(-c2sccc2Cl)oc1C(=O)O |
| InChI | InChI=1S/C9H4ClNO5S/c10-3-1-2-17-6(3)7-11-4(8(12)13)5(16-7)9(14)15/h1-2H,(H,12,13)(H,14,15) |
| InChIKey | LNMWHWTWMQRVPC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |