C11H5ClFNO5 — CID 102953761
2-(2-chloro-6-fluorophenyl)-1,3-oxazole-4,5-dicarboxylic acid (PubChem CID 102953761) has the molecular formula C11H5ClFNO5 and a molecular weight of 285.61 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1,3-oxazole-4,5-dicarboxylic acid.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1,3-oxazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 102953761 |
| Molecular Formula | C11H5ClFNO5 |
| Molecular Weight | 285.61 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1,3-oxazole-4,5-dicarboxylic acid |
| SMILES | O=C(O)c1nc(-c2c(F)cccc2Cl)oc1C(=O)O |
| InChI | InChI=1S/C11H5ClFNO5/c12-4-2-1-3-5(13)6(4)9-14-7(10(15)16)8(19-9)11(17)18/h1-3H,(H,15,16)(H,17,18) |
| InChIKey | CJFPETGOQHLFPK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.61 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |