C13H7ClN2O3S — CID 80641650
4-[5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazol-3-yl]benzoic acid (PubChem CID 80641650) has the molecular formula C13H7ClN2O3S and a molecular weight of 306.73 g/mol. Its IUPAC name is 4-[5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazol-3-yl]benzoic acid.
| Compound Name | 4-[5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 80641650 |
| Molecular Formula | C13H7ClN2O3S |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 4-[5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazol-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2noc(-c3sccc3Cl)n2)cc1 |
| InChI | InChI=1S/C13H7ClN2O3S/c14-9-5-6-20-10(9)12-15-11(16-19-12)7-1-3-8(4-2-7)13(17)18/h1-6H,(H,17,18) |
| InChIKey | HYXAQDAJIYFYBH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |