C18H17Cl2N3O3S — CID 69104446
methyl 4-[[2-chloro-5-[5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]butanoate (PubChem CID 69104446) has the molecular formula C18H17Cl2N3O3S and a molecular weight of 426.33 g/mol. Its IUPAC name is methyl 4-[[2-chloro-5-[5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]butanoate.
| Compound Name | methyl 4-[[2-chloro-5-[5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]butanoate |
|---|---|
| PubChem CID | 69104446 |
| Molecular Formula | C18H17Cl2N3O3S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | methyl 4-[[2-chloro-5-[5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]butanoate |
| SMILES | COC(=O)CCCNCc1cc(-c2noc(-c3sccc3Cl)n2)ccc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O3S/c1-25-15(24)3-2-7-21-10-12-9-11(4-5-13(12)19)17-22-18(26-23-17)16-14(20)6-8-27-16/h4-6,8-9,21H,2-3,7,10H2,1H3 |
| InChIKey | CEWMUWYVAQMXRN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|