C28H26FN3O5 — CID 143783905
methyl 4-[[2-fluoro-4-[5-[3-(hydroxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoyl]amino]butanoate (PubChem CID 143783905) has the molecular formula C28H26FN3O5 and a molecular weight of 503.53 g/mol. Its IUPAC name is methyl 4-[[2-fluoro-4-[5-[3-(hydroxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoyl]amino]butanoate.
| Compound Name | methyl 4-[[2-fluoro-4-[5-[3-(hydroxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 143783905 |
| Molecular Formula | C28H26FN3O5 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | methyl 4-[[2-fluoro-4-[5-[3-(hydroxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1ccc(-c2noc(-c3ccc(-c4ccccc4C)c(CO)c3)n2)cc1F |
| InChI | InChI=1S/C28H26FN3O5/c1-17-6-3-4-7-21(17)22-11-10-19(14-20(22)16-33)28-31-26(32-37-28)18-9-12-23(24(29)15-18)27(35)30-13-5-8-25(34)36-2/h3-4,6-7,9-12,14-15,33H,5,8,13,16H2,1-2H3,(H,30,35) |
| InChIKey | KZKROFBTKZAACY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|