C29H28F2N2O5 — CID 66678371
ethyl 4-[2,3-difluoro-5-[5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenoxy]butanoate (PubChem CID 66678371) has the molecular formula C29H28F2N2O5 and a molecular weight of 522.55 g/mol. Its IUPAC name is ethyl 4-[2,3-difluoro-5-[5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenoxy]butanoate.
| Compound Name | ethyl 4-[2,3-difluoro-5-[5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenoxy]butanoate |
|---|---|
| PubChem CID | 66678371 |
| Molecular Formula | C29H28F2N2O5 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | ethyl 4-[2,3-difluoro-5-[5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cc(-c2noc(-c3ccc(-c4ccccc4C)c(COC)c3)n2)cc(F)c1F |
| InChI | InChI=1S/C29H28F2N2O5/c1-4-36-26(34)10-7-13-37-25-16-20(15-24(30)27(25)31)28-32-29(38-33-28)19-11-12-23(21(14-19)17-35-3)22-9-6-5-8-18(22)2/h5-6,8-9,11-12,14-16H,4,7,10,13,17H2,1-3H3 |
| InChIKey | HWHUYQUKRXPFPP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|