C12H8N2O7 — CID 102953982
2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid (PubChem CID 102953982) has the molecular formula C12H8N2O7 and a molecular weight of 292.20 g/mol. Its IUPAC name is 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid.
| Compound Name | 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 102953982 |
| Molecular Formula | C12H8N2O7 |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid |
| SMILES | Cc1ccc(-c2nc(C(=O)O)c(C(=O)O)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8N2O7/c1-5-2-3-6(4-7(5)14(19)20)10-13-8(11(15)16)9(21-10)12(17)18/h2-4H,1H3,(H,15,16)(H,17,18) |
| InChIKey | PCRVOHXOLCSVJQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 143.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|