2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid

C12H8N2O7 — CID 102953982

IUPAC2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid
SMILESCc1ccc(-c2nc(C(=O)O)c(C(=O)O)o2)cc1[N+](=O)[O-]
InChIInChI=1S/C12H8N2O7/c1-5-2-3-6(4-7(5)14(19)20)10-13-8(11(15)16)9(21-10)12(17)18/h2-4H,1H3,(H,15,16)(H,17,18)
InChIKeyPCRVOHXOLCSVJQ-UHFFFAOYSA-N
MW292.20 g/mol
LogP1.95
Rot. Bonds4

About 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid

2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid (PubChem CID 102953982) has the molecular formula C12H8N2O7 and a molecular weight of 292.20 g/mol. Its IUPAC name is 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid.

Molecular Properties

Compound Name2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid
PubChem CID102953982
Molecular FormulaC12H8N2O7
Molecular Weight292.20 g/mol
Exact Mass292.03
IUPAC Name2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid
SMILESCc1ccc(-c2nc(C(=O)O)c(C(=O)O)o2)cc1[N+](=O)[O-]
InChIInChI=1S/C12H8N2O7/c1-5-2-3-6(4-7(5)14(19)20)10-13-8(11(15)16)9(21-10)12(17)18/h2-4H,1H3,(H,15,16)(H,17,18)
InChIKeyPCRVOHXOLCSVJQ-UHFFFAOYSA-N
XLogP1.95
TPSA143.77 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.20
LogP ≤ 51.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid?
The IUPAC name of 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid (CID 102953982) is 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid.
What is the SMILES notation for 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid?
The canonical SMILES for 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid is Cc1ccc(-c2nc(C(=O)O)c(C(=O)O)o2)cc1[N+](=O)[O-].
What is the InChIKey of 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid?
The InChIKey is PCRVOHXOLCSVJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O7/c1-5-2-3-6(4-7(5)14(19)20)10-13-8(11(15)16)9(21-10)12(17)18/h2-4H,1H3,(H,15,16)(H,17,18).
What are the key properties of 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid?
2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid has a molecular weight of 292.20 g/mol, XLogP of 1.95, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4,5-dicarboxylic acid is sourced from PubChem (CID 102953982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).