C12H11N3O6 — CID 61327708
2-[[5-(4-methyl-3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methoxy]acetic acid (PubChem CID 61327708) has the molecular formula C12H11N3O6 and a molecular weight of 293.24 g/mol. Its IUPAC name is 2-[[5-(4-methyl-3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methoxy]acetic acid.
| Compound Name | 2-[[5-(4-methyl-3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 61327708 |
| Molecular Formula | C12H11N3O6 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-[[5-(4-methyl-3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methoxy]acetic acid |
| SMILES | Cc1ccc(-c2nnc(COCC(=O)O)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N3O6/c1-7-2-3-8(4-9(7)15(18)19)12-14-13-10(21-12)5-20-6-11(16)17/h2-4H,5-6H2,1H3,(H,16,17) |
| InChIKey | ZIYVFVFUTFGNDG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|