C17H14N2O6 — CID 2974348
6,7-dimethoxy-2-(4-methyl-3-nitrophenyl)-3,1-benzoxazin-4-one (PubChem CID 2974348) has the molecular formula C17H14N2O6 and a molecular weight of 342.31 g/mol. Its IUPAC name is 6,7-dimethoxy-2-(4-methyl-3-nitrophenyl)-3,1-benzoxazin-4-one.
| Compound Name | 6,7-dimethoxy-2-(4-methyl-3-nitrophenyl)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 2974348 |
| Molecular Formula | C17H14N2O6 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 6,7-dimethoxy-2-(4-methyl-3-nitrophenyl)-3,1-benzoxazin-4-one |
| SMILES | COc1cc2nc(-c3ccc(C)c([N+](=O)[O-])c3)oc(=O)c2cc1OC |
| InChI | InChI=1S/C17H14N2O6/c1-9-4-5-10(6-13(9)19(21)22)16-18-12-8-15(24-3)14(23-2)7-11(12)17(20)25-16/h4-8H,1-3H3 |
| InChIKey | RICYZPTZSUSXTK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|