C17H11BrN2O4 — CID 1345437
2-(4-bromophenyl)-4-(4-methyl-3-nitrophenyl)-1,3-oxazin-6-one (PubChem CID 1345437) has the molecular formula C17H11BrN2O4 and a molecular weight of 387.19 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-(4-methyl-3-nitrophenyl)-1,3-oxazin-6-one.
| Compound Name | 2-(4-bromophenyl)-4-(4-methyl-3-nitrophenyl)-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 1345437 |
| Molecular Formula | C17H11BrN2O4 |
| Molecular Weight | 387.19 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 2-(4-bromophenyl)-4-(4-methyl-3-nitrophenyl)-1,3-oxazin-6-one |
| SMILES | Cc1ccc(-c2cc(=O)oc(-c3ccc(Br)cc3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11BrN2O4/c1-10-2-3-12(8-15(10)20(22)23)14-9-16(21)24-17(19-14)11-4-6-13(18)7-5-11/h2-9H,1H3 |
| InChIKey | WSAYBXLJYIYJCN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|