C13H8ClN3O3 — CID 82337729
6-chloro-2-(4-methyl-3-nitrophenyl)-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 82337729) has the molecular formula C13H8ClN3O3 and a molecular weight of 289.68 g/mol. Its IUPAC name is 6-chloro-2-(4-methyl-3-nitrophenyl)-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 6-chloro-2-(4-methyl-3-nitrophenyl)-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 82337729 |
| Molecular Formula | C13H8ClN3O3 |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 6-chloro-2-(4-methyl-3-nitrophenyl)-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Cc1ccc(-c2nc3cc(Cl)cnc3o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H8ClN3O3/c1-7-2-3-8(4-11(7)17(18)19)12-16-10-5-9(14)6-15-13(10)20-12/h2-6H,1H3 |
| InChIKey | HSWLKLNCMGCUIL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|