C18H14ClN3O4 — CID 1419181
2-(4-chloro-3-nitrophenyl)-4-[4-(dimethylamino)phenyl]-1,3-oxazin-6-one (PubChem CID 1419181) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is 2-(4-chloro-3-nitrophenyl)-4-[4-(dimethylamino)phenyl]-1,3-oxazin-6-one.
| Compound Name | 2-(4-chloro-3-nitrophenyl)-4-[4-(dimethylamino)phenyl]-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 1419181 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2-(4-chloro-3-nitrophenyl)-4-[4-(dimethylamino)phenyl]-1,3-oxazin-6-one |
| SMILES | CN(C)c1ccc(-c2cc(=O)oc(-c3ccc(Cl)c([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C18H14ClN3O4/c1-21(2)13-6-3-11(4-7-13)15-10-17(23)26-18(20-15)12-5-8-14(19)16(9-12)22(24)25/h3-10H,1-2H3 |
| InChIKey | MJUSSFHIRFUKMG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|