C25H23ClN6O3 — CID 3928969
(4-chloro-3-nitrophenyl)-[5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-methylphenyl)-1,2,4-triazol-1-yl]methanone (PubChem CID 3928969) has the molecular formula C25H23ClN6O3 and a molecular weight of 490.95 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-[5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-methylphenyl)-1,2,4-triazol-1-yl]methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-[5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-methylphenyl)-1,2,4-triazol-1-yl]methanone |
|---|---|
| PubChem CID | 3928969 |
| Molecular Formula | C25H23ClN6O3 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-methylphenyl)-1,2,4-triazol-1-yl]methanone |
| SMILES | Cc1ccc(-c2nc(NCc3ccc(N(C)C)cc3)n(C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C25H23ClN6O3/c1-16-4-8-18(9-5-16)23-28-25(27-15-17-6-11-20(12-7-17)30(2)3)31(29-23)24(33)19-10-13-21(26)22(14-19)32(34)35/h4-14H,15H2,1-3H3,(H,27,28,29) |
| InChIKey | XWKCLZLNNGEGRY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|