C25H24ClN5O2 — CID 4986110
2-(4-chlorophenoxy)-1-[5-[[4-(dimethylamino)phenyl]methylamino]-3-phenyl-1,2,4-triazol-1-yl]ethanone (PubChem CID 4986110) has the molecular formula C25H24ClN5O2 and a molecular weight of 461.95 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-[5-[[4-(dimethylamino)phenyl]methylamino]-3-phenyl-1,2,4-triazol-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenoxy)-1-[5-[[4-(dimethylamino)phenyl]methylamino]-3-phenyl-1,2,4-triazol-1-yl]ethanone |
|---|---|
| PubChem CID | 4986110 |
| Molecular Formula | C25H24ClN5O2 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-[5-[[4-(dimethylamino)phenyl]methylamino]-3-phenyl-1,2,4-triazol-1-yl]ethanone |
| SMILES | CN(C)c1ccc(CNc2nc(-c3ccccc3)nn2C(=O)COc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H24ClN5O2/c1-30(2)21-12-8-18(9-13-21)16-27-25-28-24(19-6-4-3-5-7-19)29-31(25)23(32)17-33-22-14-10-20(26)11-15-22/h3-15H,16-17H2,1-2H3,(H,27,28,29) |
| InChIKey | SIHHTFKTOJPVKQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|