C23H22N6O — CID 3911196
[5-[[4-(dimethylamino)phenyl]methylamino]-3-phenyl-1,2,4-triazol-1-yl]-pyridin-4-ylmethanone (PubChem CID 3911196) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is [5-[[4-(dimethylamino)phenyl]methylamino]-3-phenyl-1,2,4-triazol-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [5-[[4-(dimethylamino)phenyl]methylamino]-3-phenyl-1,2,4-triazol-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 3911196 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [5-[[4-(dimethylamino)phenyl]methylamino]-3-phenyl-1,2,4-triazol-1-yl]-pyridin-4-ylmethanone |
| SMILES | CN(C)c1ccc(CNc2nc(-c3ccccc3)nn2C(=O)c2ccncc2)cc1 |
| InChI | InChI=1S/C23H22N6O/c1-28(2)20-10-8-17(9-11-20)16-25-23-26-21(18-6-4-3-5-7-18)27-29(23)22(30)19-12-14-24-15-13-19/h3-15H,16H2,1-2H3,(H,25,26,27) |
| InChIKey | SXGFBSXOAPZDDY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|