C19H23N5O2S — CID 3915926
N-[[4-(dimethylamino)phenyl]methyl]-2-ethylsulfonyl-5-phenyl-1,2,4-triazol-3-amine (PubChem CID 3915926) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-ethylsulfonyl-5-phenyl-1,2,4-triazol-3-amine.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-ethylsulfonyl-5-phenyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 3915926 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-ethylsulfonyl-5-phenyl-1,2,4-triazol-3-amine |
| SMILES | CCS(=O)(=O)n1nc(-c2ccccc2)nc1NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H23N5O2S/c1-4-27(25,26)24-19(21-18(22-24)16-8-6-5-7-9-16)20-14-15-10-12-17(13-11-15)23(2)3/h5-13H,4,14H2,1-3H3,(H,20,21,22) |
| InChIKey | GTKHYAFXISFZEB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|