C24H24N6O — CID 3975096
[5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-methylphenyl)-1,2,4-triazol-1-yl]-pyridin-3-ylmethanone (PubChem CID 3975096) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is [5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-methylphenyl)-1,2,4-triazol-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-methylphenyl)-1,2,4-triazol-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 3975096 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-methylphenyl)-1,2,4-triazol-1-yl]-pyridin-3-ylmethanone |
| SMILES | Cc1ccc(-c2nc(NCc3ccc(N(C)C)cc3)n(C(=O)c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C24H24N6O/c1-17-6-10-19(11-7-17)22-27-24(26-15-18-8-12-21(13-9-18)29(2)3)30(28-22)23(31)20-5-4-14-25-16-20/h4-14,16H,15H2,1-3H3,(H,26,27,28) |
| InChIKey | BRBPBFUVGPNREL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|