C15H15ClN2O4S — CID 54220333
4-[(4-chloro-3-nitrophenyl)sulfonylmethyl]-N,N-dimethylaniline (PubChem CID 54220333) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is 4-[(4-chloro-3-nitrophenyl)sulfonylmethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(4-chloro-3-nitrophenyl)sulfonylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 54220333 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-[(4-chloro-3-nitrophenyl)sulfonylmethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C15H15ClN2O4S/c1-17(2)12-5-3-11(4-6-12)10-23(21,22)13-7-8-14(16)15(9-13)18(19)20/h3-9H,10H2,1-2H3 |
| InChIKey | QCDFTBNMKUFHRF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|