C18H21ClN2O6S2 — CID 31391193
N-(4-chloro-3-nitrophenyl)sulfonyl-N,2,3,4,5,6-hexamethylbenzenesulfonamide (PubChem CID 31391193) has the molecular formula C18H21ClN2O6S2 and a molecular weight of 460.96 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)sulfonyl-N,2,3,4,5,6-hexamethylbenzenesulfonamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)sulfonyl-N,2,3,4,5,6-hexamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 31391193 |
| Molecular Formula | C18H21ClN2O6S2 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)sulfonyl-N,2,3,4,5,6-hexamethylbenzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N(C)S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c(C)c1C |
| InChI | InChI=1S/C18H21ClN2O6S2/c1-10-11(2)13(4)18(14(5)12(10)3)29(26,27)20(6)28(24,25)15-7-8-16(19)17(9-15)21(22)23/h7-9H,1-6H3 |
| InChIKey | CAQPLTKOXKVFOS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|