C12H5BrClN3O4 — CID 4916153
3-(5-bromofuran-2-yl)-5-(4-chloro-3-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 4916153) has the molecular formula C12H5BrClN3O4 and a molecular weight of 370.55 g/mol. Its IUPAC name is 3-(5-bromofuran-2-yl)-5-(4-chloro-3-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(5-bromofuran-2-yl)-5-(4-chloro-3-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 4916153 |
| Molecular Formula | C12H5BrClN3O4 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 368.92 |
| IUPAC Name | 3-(5-bromofuran-2-yl)-5-(4-chloro-3-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(-c2nc(-c3ccc(Br)o3)no2)ccc1Cl |
| InChI | InChI=1S/C12H5BrClN3O4/c13-10-4-3-9(20-10)11-15-12(21-16-11)6-1-2-7(14)8(5-6)17(18)19/h1-5H |
| InChIKey | ONQJXDMCEXETRW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 95.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|