C15H8ClN3O5 — CID 5301187
3-(1,3-benzodioxol-5-yl)-5-(4-chloro-3-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 5301187) has the molecular formula C15H8ClN3O5 and a molecular weight of 345.70 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-(4-chloro-3-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-(4-chloro-3-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 5301187 |
| Molecular Formula | C15H8ClN3O5 |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-(4-chloro-3-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(-c2nc(-c3ccc4c(c3)OCO4)no2)ccc1Cl |
| InChI | InChI=1S/C15H8ClN3O5/c16-10-3-1-9(5-11(10)19(20)21)15-17-14(18-24-15)8-2-4-12-13(6-8)23-7-22-12/h1-6H,7H2 |
| InChIKey | ZVCNESJSTAZVLI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 100.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|