C24H20N6O5 — CID 71689807
5-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-3-nitrophenyl]-3-pyridin-2-yl-1,2,4-oxadiazole (PubChem CID 71689807) has the molecular formula C24H20N6O5 and a molecular weight of 472.46 g/mol. Its IUPAC name is 5-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-3-nitrophenyl]-3-pyridin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-3-nitrophenyl]-3-pyridin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 71689807 |
| Molecular Formula | C24H20N6O5 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 5-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-3-nitrophenyl]-3-pyridin-2-yl-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(-c2nc(-c3ccccn3)no2)ccc1N1CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C24H20N6O5/c31-30(32)20-13-16(24-26-23(27-35-24)18-3-1-2-8-25-18)4-6-19(20)29-11-9-28(10-12-29)17-5-7-21-22(14-17)34-15-33-21/h1-8,13-14H,9-12,15H2 |
| InChIKey | ASNDZUSYVJZVQI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 119.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|