C19H19N5O3 — CID 92703273
5-[4-[(3S)-3-methylpiperidin-1-yl]-3-nitrophenyl]-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 92703273) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 5-[4-[(3S)-3-methylpiperidin-1-yl]-3-nitrophenyl]-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-[4-[(3S)-3-methylpiperidin-1-yl]-3-nitrophenyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 92703273 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 5-[4-[(3S)-3-methylpiperidin-1-yl]-3-nitrophenyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | C[C@H]1CCCN(c2ccc(-c3nc(-c4ccncc4)no3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H19N5O3/c1-13-3-2-10-23(12-13)16-5-4-15(11-17(16)24(25)26)19-21-18(22-27-19)14-6-8-20-9-7-14/h4-9,11,13H,2-3,10,12H2,1H3/t13-/m0/s1 |
| InChIKey | LNVWLAXGDPPIRW-ZDUSSCGKSA-N |
| XLogP | 3.94 |
| TPSA | 98.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|