C22H24N6O4 — CID 78839036
4-(3,5-dimethylpiperidin-1-yl)-3-nitro-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide (PubChem CID 78839036) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)-3-nitro-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)-3-nitro-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 78839036 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)-3-nitro-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
| SMILES | CC1CC(C)CN(c2ccc(C(=O)NCc3nc(-c4ccncc4)no3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C22H24N6O4/c1-14-9-15(2)13-27(12-14)18-4-3-17(10-19(18)28(30)31)22(29)24-11-20-25-21(26-32-20)16-5-7-23-8-6-16/h3-8,10,14-15H,9,11-13H2,1-2H3,(H,24,29) |
| InChIKey | JFRMEZWKEUVFDE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|