C18H25N3O5 — CID 78773032
methyl 3-[[4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoyl]amino]propanoate (PubChem CID 78773032) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl 3-[[4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoyl]amino]propanoate |
|---|---|
| PubChem CID | 78773032 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | methyl 3-[[4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc(N2CC(C)CC(C)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H25N3O5/c1-12-8-13(2)11-20(10-12)15-5-4-14(9-16(15)21(24)25)18(23)19-7-6-17(22)26-3/h4-5,9,12-13H,6-8,10-11H2,1-3H3,(H,19,23) |
| InChIKey | AMRFXMYNYIQRMZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|