C14H15N3O7 — CID 122064617
1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]-2-nitrophenyl]azetidine-3-carboxylic acid (PubChem CID 122064617) has the molecular formula C14H15N3O7 and a molecular weight of 337.29 g/mol. Its IUPAC name is 1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]-2-nitrophenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]-2-nitrophenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122064617 |
| Molecular Formula | C14H15N3O7 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]-2-nitrophenyl]azetidine-3-carboxylic acid |
| SMILES | COC(=O)CNC(=O)c1ccc(N2CC(C(=O)O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15N3O7/c1-24-12(18)5-15-13(19)8-2-3-10(11(4-8)17(22)23)16-6-9(7-16)14(20)21/h2-4,9H,5-7H2,1H3,(H,15,19)(H,20,21) |
| InChIKey | IJBLXEOQQBIUJG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|