C19H18BrN3O5 — CID 133309008
methyl 2-[[4-(8-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrobenzoyl]amino]acetate (PubChem CID 133309008) has the molecular formula C19H18BrN3O5 and a molecular weight of 448.27 g/mol. Its IUPAC name is methyl 2-[[4-(8-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrobenzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-(8-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrobenzoyl]amino]acetate |
|---|---|
| PubChem CID | 133309008 |
| Molecular Formula | C19H18BrN3O5 |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | methyl 2-[[4-(8-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrobenzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(N2CCc3cccc(Br)c3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18BrN3O5/c1-28-18(24)10-21-19(25)13-5-6-16(17(9-13)23(26)27)22-8-7-12-3-2-4-15(20)14(12)11-22/h2-6,9H,7-8,10-11H2,1H3,(H,21,25) |
| InChIKey | UAQWGTQKCPCYEJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|