C15H17N3O7 — CID 122058973
1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]-2-nitrophenyl]pyrrolidine-2-carboxylic acid (PubChem CID 122058973) has the molecular formula C15H17N3O7 and a molecular weight of 351.32 g/mol. Its IUPAC name is 1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]-2-nitrophenyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]-2-nitrophenyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122058973 |
| Molecular Formula | C15H17N3O7 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]-2-nitrophenyl]pyrrolidine-2-carboxylic acid |
| SMILES | COC(=O)CNC(=O)c1ccc(N2CCCC2C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N3O7/c1-25-13(19)8-16-14(20)9-4-5-10(12(7-9)18(23)24)17-6-2-3-11(17)15(21)22/h4-5,7,11H,2-3,6,8H2,1H3,(H,16,20)(H,21,22) |
| InChIKey | GWGBBZWHTITRQB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|