C15H17N3O5 — CID 120965117
(2R)-1-[4-(cyclopropylcarbamoyl)-2-nitrophenyl]pyrrolidine-2-carboxylic acid (PubChem CID 120965117) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is (2R)-1-[4-(cyclopropylcarbamoyl)-2-nitrophenyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[4-(cyclopropylcarbamoyl)-2-nitrophenyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 120965117 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (2R)-1-[4-(cyclopropylcarbamoyl)-2-nitrophenyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(NC1CC1)c1ccc(N2CCC[C@@H]2C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N3O5/c19-14(16-10-4-5-10)9-3-6-11(13(8-9)18(22)23)17-7-1-2-12(17)15(20)21/h3,6,8,10,12H,1-2,4-5,7H2,(H,16,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | YBFSRAXXOTZUDP-GFCCVEGCSA-N |
| XLogP | 1.54 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|