C15H19N3O4 — CID 133410674
N-cyclopropyl-4-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-nitrobenzamide (PubChem CID 133410674) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is N-cyclopropyl-4-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-nitrobenzamide.
| Compound Name | N-cyclopropyl-4-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 133410674 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-cyclopropyl-4-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-nitrobenzamide |
| SMILES | CC1(O)CCN(c2ccc(C(=O)NC3CC3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H19N3O4/c1-15(20)6-7-17(9-15)12-5-2-10(8-13(12)18(21)22)14(19)16-11-3-4-11/h2,5,8,11,20H,3-4,6-7,9H2,1H3,(H,16,19) |
| InChIKey | DEVIVBVCQBMZJM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|