C20H29N5O3 — CID 133292760
N-cyclopropyl-4-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-3-nitrobenzamide (PubChem CID 133292760) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-cyclopropyl-4-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-3-nitrobenzamide.
| Compound Name | N-cyclopropyl-4-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 133292760 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-cyclopropyl-4-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-3-nitrobenzamide |
| SMILES | CCN1CCN(C2CCN(c3ccc(C(=O)NC4CC4)cc3[N+](=O)[O-])C2)CC1 |
| InChI | InChI=1S/C20H29N5O3/c1-2-22-9-11-23(12-10-22)17-7-8-24(14-17)18-6-3-15(13-19(18)25(27)28)20(26)21-16-4-5-16/h3,6,13,16-17H,2,4-5,7-12,14H2,1H3,(H,21,26) |
| InChIKey | WKMHIVDSYFKWJI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|