C16H23BrN4O2 — CID 133320422
1-[1-(2-bromo-4-nitrophenyl)pyrrolidin-3-yl]-4-ethylpiperazine (PubChem CID 133320422) has the molecular formula C16H23BrN4O2 and a molecular weight of 383.29 g/mol. Its IUPAC name is 1-[1-(2-bromo-4-nitrophenyl)pyrrolidin-3-yl]-4-ethylpiperazine.
| Compound Name | 1-[1-(2-bromo-4-nitrophenyl)pyrrolidin-3-yl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 133320422 |
| Molecular Formula | C16H23BrN4O2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-[1-(2-bromo-4-nitrophenyl)pyrrolidin-3-yl]-4-ethylpiperazine |
| SMILES | CCN1CCN(C2CCN(c3ccc([N+](=O)[O-])cc3Br)C2)CC1 |
| InChI | InChI=1S/C16H23BrN4O2/c1-2-18-7-9-19(10-8-18)14-5-6-20(12-14)16-4-3-13(21(22)23)11-15(16)17/h3-4,11,14H,2,5-10,12H2,1H3 |
| InChIKey | XWVWLCUVZFRZHA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|