C20H28N4O3 — CID 133396299
N-cyclopropyl-4-[4-(2-methylpyrrolidin-1-yl)piperidin-1-yl]-3-nitrobenzamide (PubChem CID 133396299) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-cyclopropyl-4-[4-(2-methylpyrrolidin-1-yl)piperidin-1-yl]-3-nitrobenzamide.
| Compound Name | N-cyclopropyl-4-[4-(2-methylpyrrolidin-1-yl)piperidin-1-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 133396299 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-cyclopropyl-4-[4-(2-methylpyrrolidin-1-yl)piperidin-1-yl]-3-nitrobenzamide |
| SMILES | CC1CCCN1C1CCN(c2ccc(C(=O)NC3CC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H28N4O3/c1-14-3-2-10-23(14)17-8-11-22(12-9-17)18-7-4-15(13-19(18)24(26)27)20(25)21-16-5-6-16/h4,7,13-14,16-17H,2-3,5-6,8-12H2,1H3,(H,21,25) |
| InChIKey | MWLAZQSSLGQONZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|