C15H17N3O5 — CID 133362138
methyl 2-[[4-(cyclopent-3-en-1-ylamino)-3-nitrobenzoyl]amino]acetate (PubChem CID 133362138) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is methyl 2-[[4-(cyclopent-3-en-1-ylamino)-3-nitrobenzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-(cyclopent-3-en-1-ylamino)-3-nitrobenzoyl]amino]acetate |
|---|---|
| PubChem CID | 133362138 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | methyl 2-[[4-(cyclopent-3-en-1-ylamino)-3-nitrobenzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC2CC=CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N3O5/c1-23-14(19)9-16-15(20)10-6-7-12(13(8-10)18(21)22)17-11-4-2-3-5-11/h2-3,6-8,11,17H,4-5,9H2,1H3,(H,16,20) |
| InChIKey | ZQLGKOHUUHSCFO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|